Urolitin B (1139-83-9) İstehsalçı fabriki

Urolitin B

Noyabr 9, 2020

Urolitin BSpecifications

Adı: Urolitin B
Kimyəvi adı: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-bir
CAS: 1139-83-9
Kimyəvi Formula: C13H8O3
Molekulyar çəki: X
Rəng:  Ağ toz
InChi Açar: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES Kodu: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Function: Urolitin B mitokondrial və əzələ fəaliyyətini yaxşılaşdıra bilər.

Urolitin B yaşlanma dövründə əzələ gücünü və dözümlülüyünü artıra bilər.

Application: Urolithin B, ellagitannisin bağırsaq mikrob metabolitidir və təhlili sistemindən və şəraitindən asılı olaraq güclü antioksidant və pro-oksidant aktivliyi nümayiş etdirir. Urolithin B, estrogen və / və ya anti-estrogenik fəaliyyət göstərə bilər.
Çözünürlük: N, N-dimetilformamid və dimetilmetilendə asanlıqla həll olunur. Metanol, etanol və etil asetatda bir az həll olunan sulfon
Saxlama tempi: Hygroscopic, 20 ° C Dondurucu, İnert atmosferdə
Göndərmə Vəziyyəti: Təhlükəsiz kimyəvi maddələr kimi ətraf temperaturu altında göndərilir. Bu məhsul normal gəmiçilikdə və gömrük dövründə bir neçə həftə ərzində kifayət qədər sabitdir.