Urolitin B tozu

Noyabr 9, 2020

Cofttek, Çindəki ən yaxşı Urolithin B tozu istehsalçısıdır. Fabrikamız aylıq istehsal gücü 9001 kq olan tam istehsal idarəetmə sisteminə (ISO14001 və ISO200) malikdir.

 


Status: Kütləvi istehsalda
Vahidi: 1kg / bag, 25kg / Drum

Urolitin BSpecifications

Adı: Urolitin B
Kimyəvi adı: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-bir
CAS: 1139-83-9
Kimyəvi Formula: C13H8O3
Molekulyar çəki: X
Rəng:  Ağ toz
InChi Açar: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES Kodu: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Function: Urolitin B mitokondrial və əzələ fəaliyyətini yaxşılaşdıra bilər.

Urolitin B yaşlanma dövründə əzələ gücünü və dözümlülüyünü artıra bilər.

Application: Urolithin B, ellagitannisin bağırsaq mikrob metabolitidir və təhlili sistemindən və şəraitindən asılı olaraq güclü antioksidant və pro-oksidant aktivliyi nümayiş etdirir. Urolithin B, estrogen və / və ya anti-estrogenik fəaliyyət göstərə bilər.
Çözünürlük: N, N-dimetilformamid və dimetilmetilendə asanlıqla həll olunur. Metanol, etanol və etil asetatda bir az həll olunan sulfon
Saxlama tempi: Hygroscopic, 20 ° C Dondurucu, İnert atmosferdə
Göndərmə Vəziyyəti: Təhlükəsiz kimyəvi maddələr kimi ətraf temperaturu altında göndərilir. Bu məhsul normal gəmiçilikdə və gömrük dövründə bir neçə həftə ərzində kifayət qədər sabitdir.

 

Urolitin B NMR Spektri

Urolitin B (1139-83-9) - NMR Spektri

 

Hər məhsul partiyası üçün COA, MSDS, HNMR və digər məlumatlara ehtiyacınız varsa, xahiş edirik bizimlə əlaqə saxlayın marketinq Meneceri.

 

Urolitinlərə giriş

Urolitinlər ellagitanninlərdən alınan ellagik turşusunun ikincil metabolitləridir. İnsanlarda ellagitanninlər bağırsaq mikroflorası ilə ellagik turşusuna çevrilir və daha sonra yoğun bağırsaqlarda urolitin A, urolitin B, urolitin C və urolitin D-ə çevrilir.

Urolitin A (UA) ellagitanninin ən çox yayılmış metabolitidir. Bununla birlikdə, urolitin A-nın heç bir pəhriz qaynağında təbii olaraq meydana gəldiyi bilinmir.

Urolitin B (UB), ellagitanninlərin çevrilməsi yolu ilə bağırsaqda əmələ gələn bol metabolitdir. Urolitin B, bütün digər urolitin törəmələrinin katabolizə edilməsindən sonra son məhsuldur. Urolitin B sidikdə urolitin B qlükuronid olaraq tapılır.

Urolitin A 8-Metil Eter, Urolitin A-nın sintezi zamanı ara məhsuldur, ellagitanninin əhəmiyyətli bir ikinci dərəcəli metabolitidir və antioksidan və antiinflamatuar xüsusiyyətlərə malikdir.

 

Ürolitinin A və B-nin təsir mexanizmi

● Urolitin A mitofagiyi əmələ gətirir

Mitofagiya, optimal işləmələri üçün zədələnmiş mitokondriyanı aradan qaldırmağa kömək edən otofagiyanın bir formasıdır. Otofagiya, sitoplazmatik məzmunun pozulduğu və nəticədə təkrar emal edildiyi ümumi prosesə aiddir, mitofagiya isə mitokondrinin deqradasiyası və təkrar emalı.

Yaşlanma zamanı otofagiyada azalma mitokondrial funksiyanın azalmasına səbəb olan cəhətlərdən biridir. Bundan əlavə, oksidləşdirici stres də aşağı otofagiyaya səbəb ola bilər. Urolitin A zədələnmiş mitokondriyanı selektiv otofagiya yolu ilə aradan qaldırmaq qabiliyyətinə malikdir.

● Antioksidan xüsusiyyətləri

Bədəndə sərbəst radikallar və antioksidan arasında balanssızlıq olduqda oksidativ stres meydana gəlir. Bu artıq sərbəst radikallar bir çox xroniki xəstəliklər, məsələn ürək xəstəlikləri, diabet və xərçənglə əlaqələndirilir.

Urolitinlər A və B, sərbəst radikalları və xüsusən hüceyrədaxili reaktiv oksigen növlərini (ROS) azaltmaq və müəyyən hüceyrə tiplərində lipid peroksidləşməsini maneə törətmək qabiliyyəti ilə antioksidan təsir göstərir.

Bundan əlavə, urolitinlər monoamin oksidaz A və tirosinaz da daxil olmaqla bəzi oksidləşdirici fermentləri inhibə edə bilərlər.

● İltihab əleyhinə xüsusiyyətlər

İltihab, vücudumuzun infeksiyalar, xəsarətlər və mikroblar kimi düşmüş hər şeyə qarşı mübarizə apardığı təbii bir prosesdir. Bununla birlikdə, xroniki iltihab bədən üçün zərərli ola bilər, çünki bu astma, ürək problemləri və xərçəng kimi müxtəlif xəstəliklərlə əlaqələndirilir. Xroniki iltihab müalicə olunmayan kəskin iltihab, infeksiyalar və ya hətta bədəndəki sərbəst radikallar səbəbindən baş verə bilər.

Urolitinlər A və B, azot oksidi istehsalını maneə törətməklə iltihab əleyhinə xüsusiyyətlər nümayiş etdirir. İlkin olaraq nitrat oksidi sintazasını (iNOS) zülal və iltihaba cavabdeh olan mRNA ifadəsini inhibə edirlər.

● Mikrob əleyhinə təsirlər

Bakteriyalar, göbələklər və viruslar da daxil olmaqla mikroblar təbii olaraq ətraf mühitdə və hətta insan bədənində meydana gəlir. Ancaq patogenlər deyilən bir neçə mikrob qrip, qızılca və malyariya kimi yoluxucu xəstəliklərə səbəb ola bilər.

Urolitin A və B kvorum hissini maneə törətməklə mikrob əleyhinə fəaliyyət göstərə bilir. Kvorum hissiyyatı bakteriyalara virulentlik və hərəkətlilik kimi infeksiya ilə əlaqəli prosesləri aşkarlamağa və nəzarət etməyə imkan verən bakterial ünsiyyət rejimidir.

● Protein qlikasiyasının qarşısını alır

Glycation bir şəkərin bir lipid və ya zülala bağlanmamasıdır. Yaşlanma ilə yanaşı diabet və digər xəstəliklərdə də əsas biomarkerdir.

Yüksək protein qlikasiyası hiperglisemiyanın ikincil təsiri diabet və Alzheimer xəstəliyi kimi ürək-damar sistemi ilə əlaqəli xəstəliklərdə böyük rol oynayır.

Urolitin A və B antioksidant fəaliyyətindən asılı olmayan dozadan asılı olan anti-glikativ xüsusiyyətlərə malikdir.

 

Urolitin B faydaları

Urolitin B əlavələri eyni zamanda bir çox sağlamlığa faydalıdır və bunların çoxu urolitin A faydalarına bənzəyir.

(1) Xərçəng əleyhinə potensial
Urolitin B-nin antiinflamatuar xüsusiyyətləri onu xərçənglə mübarizə üçün yaxşı bir namizəd halına gətirir. Bəzi tədqiqatçılar bu potensialı fibroblastlarda, mikrofaglarda və endotel hüceyrələrdə bildirdilər.

Tədqiqatlar UB-nin prostat, kolon və mesane xərçəngi kimi müxtəlif xərçəng növlərini inhibə etdiyini bildirdi.

İnsan kolon xərçəngi hüceyrələrini əhatə edən bir araşdırmada, ellagitanninlər, ellagic turşusu və A və B urolitinləri xərçəng əleyhinə potensialına görə qiymətləndirilmişdir. Bütün müalicələrin xərçəng hüceyrələrinin böyüməsini maneə törətə bildiklərini bildirdilər. Müxtəlif fazalarda hüceyrə dövrü tutulması və həmçinin apoptozu təşviq etməklə xərçəng hüceyrələrinin yayılmasını maneə törətdilər.

(2) oksidləşdirici stresə qarşı mübarizədə kömək edə bilər
Urolitin B reaktiv oksigen növlərinin səviyyəsini və müəyyən hüceyrə tiplərində lipid peroksidləşməsini azaltmaqla əla antioksidan xüsusiyyətlərə malikdir. Yüksək səviyyədə ROS, Alzheimer xəstəliyi kimi bir çox xəstəliklə əlaqələndirilir.

Oksidləşdirici stresə məruz qalan neyron hüceyrələri ilə aparılan bir araşdırmada, hüceyrələrin oksidləşmədən qorunması üçün urolitin B əlavəsi, həmçinin urolitin A tapıldı və bu səbəbdən hüceyrələrin yaşaması artdı.

(3) Yaddaşın genişləndirilməsində Urolitin B
Urolitin b-nin qan maneə keçiriciliyini yaxşılaşdırdığı bildirildi. Bu bilişsel fəaliyyətini artırır.

Tədqiqatlar göstərir ki, urolitin B ümumi idrak fəaliyyətini yaxşılaşdıraraq potensial yaddaş artırıcısı ola bilər.

(4) Əzələ itkisinin qarşısını alır
Əzələ itkisi, pozğunluq, yaşlanma və diyetdə protein çatışmazlığı kimi müxtəlif səbəblərə görə baş verə bilər. Əzələ itkisini dayandırmaq, məhdudlaşdırmaq və ya daha yaxşı qarşısını almaq üçün bir sıra tədbirlər, məşqlər, dərmanlar və amin turşuları, həmçinin polifenollar istifadə edilə bilər.

Urolitinlər polifenol kimi təsnif edilə bilər və əzələ protein sintezini aktivləşdirərək əzələlərin itirilməsinin qarşısını alaraq rol oynayır.

Siçanlar ilə aparılan bir araşdırmada, bir müddət ərzində tətbiq olunan Urolitin B əlavələri, əzələlərin böyüdüyü görüldükcə onların əzələ inkişafını artırdığı aşkar edildi.

(5) Urolitin B iltihabla mübarizə aparır
Urolitin B, iltihab markerlərinin çoxunu azaltmaqla antiinflamatuar xüsusiyyətlərə malikdir.

İndüklənmiş böyrək fibrozu ilə siçovulların araşdırmasında urolitin B böyrək zədələrinin yaxşılaşdırıldığı aşkar edilmişdir. Böyrək funksiyasını, böyrəyin morfologiyasını artırdı, böyrək zədəsi işarələrini azaldır. Bu, UB-nin böyrək iltihabını azaltmağa qadir olduğunu göstərir.

(6) urolitin A və B sinerji faydaları
Sinerjik təsirlər, idrak funksiyası və tutumu baxımından urolitin A və B kombinasiyasında da bildirilmişdir. Tədqiqat, bu birləşmənin narahatlıq və ya Alzheimer bozukluğu kimi demans ilə əlaqəli xəstəliklərin müalicəsində və ya qarşısının alınmasında istifadə edilə biləcəyini bildirdi.

Urolitinlərlə əlaqəli digər faydalar;

  • neuroprotection
  • Metabolik sindromu yaxşılaşdırır

 

Urolitin A və B qida mənbələri

Urolitinlərin heç bir pəhriz mənbəyində təbii olaraq tapılmadığı məlumdur. Bunlar ellagitanninlərdən alınan ellag turşularının çevrilməsinin məhsuludur. Ellagitanninlər bağırsaq mikrobiotası tərəfindən ellag turşularına çevrilir və ellag turşusu daha sonra bağırsaqdakı metabolitlərə (urolitinlərə) çevrilir.

Ellagitannins təbii olaraq nar, çiyələk, moruq, çiyələk, böyürtkən və böyürtkən, muskadin üzümü, badam, guavas, çay və qoz və şabalıd kimi qoz-fındıq və qırmızı şərab və viski kimi palıd yaşlı içkilər kimi qida mənbələrində meydana gəlir. palıd barelləri.

Bu səbəbdən urolitin A qidaları və urolitin B qidaları ellagitannin baxımından zəngin qidalardır. Qeyd etmək lazımdır ki, ellagitannin bioavailability, ikincil metabolitləri (urolitinlər) bioloji hazır olduqda çox məhduddur.

Urolitinlərin xaric olması və istehsalı fərdlər arasında çox dəyişir, çünki ellagitanninlərdən əmələ gələn bağırsaqdakı mikrobiotaya güvənir. Bu çevrilmədə iştirak edən spesifik bakteriyalar var və bəzilərinin yüksək, aşağı və ya uyğun mikrobiota olmadığı fərdlər arasında dəyişir. Qida mənbələri ellagitannin səviyyələrində də dəyişir. Beləliklə, ellagitanninlərin potensial faydaları bir fərddən digərinə dəyişir.

 

Urolitin A və B əlavələri

Urolitin A əlavələri və Urolitin B əlavələri bazarda ellagitanninlə zəngin qida mənbəyi əlavələri kimi asanlıqla tapılır. Urolitin A əlavələri də hazırdır. Əsasən nar əlavələri çox satılmış və uğurla istifadə edilmişdir. Bu əlavələr meyvələrdən və ya qoz-fındıqdan sintez olunur və maye və ya toz halında hazırlanır.

Müxtəlif qidalardakı ellagitannins konsentrasiyasındakı dəyişikliklər səbəbindən urolitin müştəriləri qida mənbəyini nəzərə alaraq satın alırlar. Eyni şey, urolitin B tozu və ya maye əlavələr əldə edərkən tətbiq olunur.

Ürolitin A tozu və ya B ilə aparılan bir neçə insan klinik tədqiqatı, bu əlavələrin tətbiqindən ciddi yan təsirlər olmadığını bildirmişdir.

arayış

  1. Garcia-Munoz, Cristina; Vaillant, Fabrice (2014-12-02). "Ellagitanninsin metabolik taleyi: Sağlamlığa təsiri və yenilikçi funksional qidalar üçün tədqiqat perspektivləri". Qida Elmində və Qidalanmada Kritik Baxışlar.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11 Noyabr 2009). "Nar ellagitanninlərinin bağırsaq mikrob metabolitləri olan urolitinlər, hüceyrə əsaslı bir analizdə güclü antioksidan aktivlik nümayiş etdirir". J Agric Food Chem.
  3. Bodwell, Graham; Pottie, Ian; Nandaluru, Penchal (2011). "Ters Elektron Tələbi Diels-Qoca-Urolitin M7 Ümumi Sintezi".